cas: 1016258-69-7 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate, 97%, 97% (CAS 1016258-69-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115ZP-50mg |
| cas | 1016258-69-7 |
| size | 50mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 25g | 2829.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate (CAS 1016258-69-7) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate. InChIKey: UHHUEAGCENEXAJ-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate |
| InChIKey | UHHUEAGCENEXAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)