cas: 146603-99-8 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-ethyl 4-allylpiperidine-1,4-dicarboxylate, 95% (CAS 146603-99-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323926-250MG |
| cas | 146603-99-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1237.08 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 4-O-ethyl 4-prop-2-enylpiperidine-1,4-dicarboxylate (CAS 146603-99-8) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-prop-2-enylpiperidine-1,4-dicarboxylate. InChIKey: FOOVEGXEARQUBR-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-prop-2-enylpiperidine-1,4-dicarboxylate |
| InChIKey | FOOVEGXEARQUBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CC=C |
Computed by PubChem (NCBI)