cas: 495415-09-3 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-methyl 4-hydroxypiperidine-1,4-dicarboxylate 97% (CAS 495415-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106092-100g |
| cas | 495415-09-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 11884.75 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1405.00 Pln | |
| Ambeed | 10g | 2217.12 Pln | |
| Ambeed | 25g | 3763.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106092 |
1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate (CAS 495415-09-3) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate. InChIKey: WYFPECMSBUVNET-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate |
| InChIKey | WYFPECMSBUVNET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)OC)O |
Computed by PubChem (NCBI)