cas: 1260665-09-5 — see every product listed under this CAS number, including other names
1-tert-butyl-1H-1,2,3-triazole-4-carboxylic acid, 98%, 98% (CAS 1260665-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111R1K-250mg |
| cas | 1260665-09-5 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 995.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-tert-butyltriazole-4-carboxylic acid (CAS 1260665-09-5) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 1-tert-butyltriazole-4-carboxylic acid. InChIKey: MNFXHDKCPWMRCJ-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 1-tert-butyltriazole-4-carboxylic acid |
| InChIKey | MNFXHDKCPWMRCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(N=N1)C(=O)O |
Computed by PubChem (NCBI)