cas: 1434050-99-3 — see every product listed under this CAS number, including other names
10-Bromo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1(2H)-one, 97% (CAS 1434050-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JVZ7-100mg |
| cas | 1434050-99-3 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1288.40 Pln | |
| Chemat | 250mg | 2022.80 Pln | |
| Chemat | 500mg | 3333.20 Pln | |
| Chemat | 1g | 4965.20 Pln | |
| Fluorochem | 100mg | 2387.72 Pln | |
| Fluorochem | 250mg | 3736.20 Pln | |
| Fluorochem | 500mg | 6183.26 Pln | |
| Fluorochem | 1g | 9046.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one (CAS 1434050-99-3) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: 10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one. InChIKey: UMLMHHIHKQACAJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | 10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one |
| InChIKey | UMLMHHIHKQACAJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C3N2CCNC3=O)Br |
Computed by PubChem (NCBI)