CAS 1434050-99-3 appears in our catalog under these names: 10-Bromo-3,4,6,7,8,9-hexahydropyrazino(1,2-a)indol-1(2H)-one, 95%, 10-Bromo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1(2H)-one, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one (CAS 1434050-99-3) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: 10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one. InChIKey: UMLMHHIHKQACAJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | 10-bromo-3,4,6,7,8,9-hexahydro-2H-pyrazino[1,2-a]indol-1-one |
| InChIKey | UMLMHHIHKQACAJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C3N2CCNC3=O)Br |
Computed by PubChem (NCBI)