cas: 191546-97-1 — see every product listed under this CAS number, including other names
10-Oxo Mirtazapine (Mirtazapine Impurity F), 95%, 95% (CAS 191546-97-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FBE-10mg |
| cas | 191546-97-1 |
| size | 10mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 789.20 Pln | |
| Chemat | 25mg | 1302.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-14-one (CAS 191546-97-1) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-14-one. InChIKey: RZDFSDWHGNDESU-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-14-one |
| InChIKey | RZDFSDWHGNDESU-UHFFFAOYSA-N |
| SMILES | CN1CCN2C(C1)C3=CC=CC=C3C(=O)C4=C2N=CC=C4 |
Computed by PubChem (NCBI)