Products 931353-21-8
CAS 931353-21-8 is the registry number for N2-(4-Methoxyphenyl)-4-methylquinoline-2,6-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-N-(4-methoxyphenyl)-4-methylquinoline-2,6-diamine (CAS 931353-21-8) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 2-N-(4-methoxyphenyl)-4-methylquinoline-2,6-diamine. InChIKey: RTTVGTLGJCUVDZ-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 2-N-(4-methoxyphenyl)-4-methylquinoline-2,6-diamine |
| InChIKey | RTTVGTLGJCUVDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C(C=C2)N)NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)