CAS 131365-81-6 is the registry number for 4'-Phenyl-3,4-dihydro-2h-spiro[naphthalene-1,2'-[1,3,4]triazolidine]-5'-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-phenylspiro[1,2,4-triazolidine-5,4'-2,3-dihydro-1H-naphthalene]-3-one (CAS 131365-81-6) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 2-phenylspiro[1,2,4-triazolidine-5,4'-2,3-dihydro-1H-naphthalene]-3-one. InChIKey: MHHZJYPMFYYVLT-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 2-phenylspiro[1,2,4-triazolidine-5,4'-2,3-dihydro-1H-naphthalene]-3-one |
| InChIKey | MHHZJYPMFYYVLT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C3(C1)NC(=O)N(N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)