CAS 172747-50-1 appears in our catalog under these names: SB 202474, 4-(5-Ethyl-2-(4-methoxyphenyl)-1H-imidazol-4-yl)pyridine, 98+%, SB 202474. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 100mg, 1 mg.
4-[5-ethyl-2-(4-methoxyphenyl)-1H-imidazol-4-yl]pyridine (CAS 172747-50-1) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 4-[5-ethyl-2-(4-methoxyphenyl)-1H-imidazol-4-yl]pyridine. InChIKey: MYKGURNPAUBQLJ-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 4-[5-ethyl-2-(4-methoxyphenyl)-1H-imidazol-4-yl]pyridine |
| InChIKey | MYKGURNPAUBQLJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(N1)C2=CC=C(C=C2)OC)C3=CC=NC=C3 |
Computed by PubChem (NCBI)