cas: 1012884-46-6 — see every product listed under this CAS number, including other names
11-Chloro-2-methyl-2,3-dihydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-1-one, 98%, 98% (CAS 1012884-46-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11155W-1g |
| cas | 1012884-46-6 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),7,9,11,15,17-heptaen-3-one (CAS 1012884-46-6) is a chemical compound with the molecular formula C17H12ClNO2 and a molecular weight of 297.7 g/mol. IUPAC name: 17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),7,9,11,15,17-heptaen-3-one. InChIKey: KXKUDCTZEMWVDQ-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),7,9,11,15,17-heptaen-3-one |
| InChIKey | KXKUDCTZEMWVDQ-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C1=O)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24 |
Computed by PubChem (NCBI)