CAS 6704-40-1 appears in our catalog under these names: 2-Hydroxy-3-naphthoic acid 2-chloroanilide, 95%, 2-Hydroxy-3-naphthoicacid2-chloroanilide, 98%, 3–Hydroxy–2–naphthoic Acid 2–Chloroanilide, 3-Hydroxy-2-naphthoic Acid 2-Chloroanilide, >98.0%(T), 3-Hydroxy-2-naphthoic Acid 2-Chloroanilide. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg.
N-(2-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide (CAS 6704-40-1) is a chemical compound with the molecular formula C17H12ClNO2 and a molecular weight of 297.7 g/mol. IUPAC name: N-(2-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide. InChIKey: KLNUTTQQHSRBIE-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | N-(2-chlorophenyl)-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | KLNUTTQQHSRBIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=CC=CC=C3Cl)O |
Computed by PubChem (NCBI)