CAS 4497-69-2 is the registry number for 2-(Benzylamino)-3-chloro-1,4-dihydronaphthalene-1,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(benzylamino)-3-chloronaphthalene-1,4-dione (CAS 4497-69-2) is a chemical compound with the molecular formula C17H12ClNO2 and a molecular weight of 297.7 g/mol. IUPAC name: 2-(benzylamino)-3-chloronaphthalene-1,4-dione. InChIKey: XKNFBQCDFMZPPY-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 2-(benzylamino)-3-chloronaphthalene-1,4-dione |
| InChIKey | XKNFBQCDFMZPPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)