Products 351332-56-4

CAS 351332-56-4 is the registry number for 2-(4-Chlorophenyl)-6-methylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-chlorophenyl)-6-methylquinoline-4-carboxylic acid (CAS 351332-56-4) is a chemical compound with the molecular formula C17H12ClNO2 and a molecular weight of 297.7 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-methylquinoline-4-carboxylic acid. InChIKey: UKVYTICTOCBCIP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12ClNO2
Molecular weight297.7 g/mol
IUPAC name2-(4-chlorophenyl)-6-methylquinoline-4-carboxylic acid
InChIKeyUKVYTICTOCBCIP-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)