12H-Benzofuro[2,3-a]carbazole, 97%
cas: 1338919-70-2 — see every product listed under this CAS number, including other names
12H-Benzofuro[2,3-a]carbazole, 97% (CAS 1338919-70-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A724699-1g |
| cas | 1338919-70-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 809.81 Pln | |
| Ambeed | 25g | 2634.31 Pln | |
| Ambeed | 100g | 9637.50 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 869.72 Pln | |
| BLDpharm | 25g | 2835.69 Pln | |
| BLDpharm | 100g | 10388.59 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 25g | 1888.40 Pln | |
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 25g | 2710.52 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
12H-[1]benzofuro[2,3-a]carbazole (CAS 1338919-70-2) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 12H-[1]benzofuro[2,3-a]carbazole. InChIKey: DZINJFQFEBORIC-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 12H-[1]benzofuro[2,3-a]carbazole |
| InChIKey | DZINJFQFEBORIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C5=CC=CC=C5O4 |
Computed by PubChem (NCBI)