Products 1246308-85-9
CAS 1246308-85-9 appears in our catalog under these names: 12H–Benzofuro(3,2–a)carbazole, 12H-Benzofuro[3,2-a]carbazole, 98%, 98%, 12H-Benzofuro[3,2-a]carbazole, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g.
12H-[1]benzofuro[3,2-a]carbazole (CAS 1246308-85-9) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 12H-[1]benzofuro[3,2-a]carbazole. InChIKey: DERKMBVPWKXOHM-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 12H-[1]benzofuro[3,2-a]carbazole |
| InChIKey | DERKMBVPWKXOHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)