CAS 1199616-66-4 appears in our catalog under these names: 5H–Benzofuro(3,2–c)carbazole, 5H-Benzofuro[3,2-c]carbazole, 97%, 97%, 5H-Benzofuro[3,2-c]carbazole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g.
5H-[1]benzofuro[3,2-c]carbazole (CAS 1199616-66-4) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 5H-[1]benzofuro[3,2-c]carbazole. InChIKey: XYZGAMBQUKTSIJ-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 5H-[1]benzofuro[3,2-c]carbazole |
| InChIKey | XYZGAMBQUKTSIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC4=C3OC5=CC=CC=C45 |
Computed by PubChem (NCBI)