CAS 1338919-70-2 appears in our catalog under these names: 12H–Benzofuro(2,3–A)Carbazole, 12H-Benzofuro[2,3-a]carbazole, 97%, 97%, 12H-Benzofuro[2,3-a]carbazole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
12H-[1]benzofuro[2,3-a]carbazole (CAS 1338919-70-2) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 12H-[1]benzofuro[2,3-a]carbazole. InChIKey: DZINJFQFEBORIC-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 12H-[1]benzofuro[2,3-a]carbazole |
| InChIKey | DZINJFQFEBORIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C5=CC=CC=C5O4 |
Computed by PubChem (NCBI)