cas: 1807539-06-5 — see every product listed under this CAS number, including other names
15,15-Dimethyl-13-oxo-4,7,10,14-tetraoxahexadecanoic acid, 97%, 97% (CAS 1807539-06-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I105-50mg |
| cas | 1807539-06-5 |
| size | 50mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 112.40 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 2819.60 Pln | |
| Chemat | 50g | 5229.20 Pln | |
| Chemat | 250g | 18515.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid (CAS 1807539-06-5) is a chemical compound with the molecular formula C14H26O7 and a molecular weight of 306.35 g/mol. IUPAC name: 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid. InChIKey: VDWZJPCGUNJFEE-UHFFFAOYSA-N.
| Molecular formula | C14H26O7 |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | VDWZJPCGUNJFEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)