CAS 60415-65-8 appears in our catalog under these names: Octanoyl-D-glucopyranoside, 95%, (3R,4S,5S,6R)–3,4,5–trihydroxy–6–(hydroxymethyl)tetrahydro–2H–pyran–2–yl octanoate, Octanoyl D-glucopyranoside. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth. Available pack sizes: 2g, 10g, 5g, 1g, 500mg, 2000mg, 1000mg, 5000mg.
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] octanoate (CAS 60415-65-8) is a chemical compound with the molecular formula C14H26O7 and a molecular weight of 306.35 g/mol. IUPAC name: [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] octanoate. InChIKey: MHQWMCFSLKPQTC-GQYPCLOQSA-N.
| Molecular formula | C14H26O7 |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] octanoate |
| InChIKey | MHQWMCFSLKPQTC-GQYPCLOQSA-N |
| SMILES | CCCCCCCC(=O)OC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)