CAS 208400-78-6 appears in our catalog under these names: Octyl d-glucuronic acid, 95%, Octyl D-glucuronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 2000mg.
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylic acid (CAS 208400-78-6) is a chemical compound with the molecular formula C14H26O7 and a molecular weight of 306.35 g/mol. IUPAC name: (2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylic acid. InChIKey: SYLNWYZPTDDGMH-ZAOAHOKWSA-N.
| Molecular formula | C14H26O7 |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylic acid |
| InChIKey | SYLNWYZPTDDGMH-ZAOAHOKWSA-N |
| SMILES | CCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O |
Computed by PubChem (NCBI)