CAS 1807539-06-5 appears in our catalog under these names: Carboxy-peg3-t-butyl ester, 95%, Acid–PEG3–C2–Boc, Acid-PEG3-t-butyl ester, Acid-PEG3-C2-Boc 95%, 15,15-Dimethyl-13-oxo-4,7,10,14-tetraoxahexadecanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 250mg, 50mg, 1g, 5g, 10g, 25g.
3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid (CAS 1807539-06-5) is a chemical compound with the molecular formula C14H26O7 and a molecular weight of 306.35 g/mol. IUPAC name: 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid. InChIKey: VDWZJPCGUNJFEE-UHFFFAOYSA-N.
| Molecular formula | C14H26O7 |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | VDWZJPCGUNJFEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)