cas: 436091-31-5 — see every product listed under this CAS number, including other names
1H-Benzimidazole-1-butanoic acid, 98%, 98% (CAS 436091-31-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1184HX-1g |
| cas | 436091-31-5 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1086.80 Pln | |
| Chemat | 500mg | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(benzimidazol-1-yl)butanoic acid (CAS 436091-31-5) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 4-(benzimidazol-1-yl)butanoic acid. InChIKey: UZPPPCKAOWOOBS-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4-(benzimidazol-1-yl)butanoic acid |
| InChIKey | UZPPPCKAOWOOBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2CCCC(=O)O |
Computed by PubChem (NCBI)