Products 120379-81-9
CAS 120379-81-9 appears in our catalog under these names: 5-(2-Phenylethyl)imidazolidine-2,4-dione, 95%, 5-(2-Phenylethyl)imidazolidine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-(2-phenylethyl)imidazolidine-2,4-dione (CAS 120379-81-9) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 5-(2-phenylethyl)imidazolidine-2,4-dione. InChIKey: WADHXSHSHULALT-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 5-(2-phenylethyl)imidazolidine-2,4-dione |
| InChIKey | WADHXSHSHULALT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)