CAS 10125-07-2 appears in our catalog under these names: Cyclo(-gly-phe), 97%, Cyclo(-Gly-Phe), >95% (HPLC), Cyclo(–Gly–Phe), cyclo(-Gly-Phe), 98%, 98%, (S)-3-Benzylpiperazine-2,5-dione, 98%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 500mg, 100mg.
(3S)-3-benzylpiperazine-2,5-dione (CAS 10125-07-2) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: (3S)-3-benzylpiperazine-2,5-dione. InChIKey: UZOJHXFWJFSFAI-VIFPVBQESA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (3S)-3-benzylpiperazine-2,5-dione |
| InChIKey | UZOJHXFWJFSFAI-VIFPVBQESA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)