CAS 18502-18-6 appears in our catalog under these names: 3-(2-Methyl-1h-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid, 95%, 3–(2–Methyl–1H–pyrrolo(2,3–b)pyridin–3–yl)propanoic acid, 3-(2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid 95%, 3-(2-Methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 500mg, 100mg, 1g, 50mg.
3-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS 18502-18-6) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid. InChIKey: ZHXHNDUVHOZKCW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid |
| InChIKey | ZHXHNDUVHOZKCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)N=CC=C2)CCC(=O)O |
Computed by PubChem (NCBI)