cas: 41354-03-4 — see every product listed under this CAS number, including other names
1H-Indazole-3-carboxylic acid, 1-(phenylmethyl)-, 98%, 98% (CAS 41354-03-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I947-100mg |
| cas | 41354-03-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 232.40 Pln | |
| Chemat | 1g | 304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-benzylindazole-3-carboxylic acid (CAS 41354-03-4) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 1-benzylindazole-3-carboxylic acid. InChIKey: CDRCOZFGMPTGBL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 1-benzylindazole-3-carboxylic acid |
| InChIKey | CDRCOZFGMPTGBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)C(=O)O |
Computed by PubChem (NCBI)