CAS 19807-86-4 is the registry number for 2-Benzyl-3H-phthalazine-1,4-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-benzyl-2H-phthalazine-1,4-dione (CAS 19807-86-4) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 3-benzyl-2H-phthalazine-1,4-dione. InChIKey: RKOOIIAURSVDRU-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 3-benzyl-2H-phthalazine-1,4-dione |
| InChIKey | RKOOIIAURSVDRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)