CAS 886362-48-7 appears in our catalog under these names: N-(4-Cyano-phenyl)-2-(4-hydroxy-phenyl)-acetamide, 97%, N-(4-Cyanophenyl)-2-(4-hydroxyphenyl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide (CAS 886362-48-7) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide. InChIKey: ALNUBQVQYXHOCQ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide |
| InChIKey | ALNUBQVQYXHOCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)NC2=CC=C(C=C2)C#N)O |
Computed by PubChem (NCBI)