CAS 77147-14-9 appears in our catalog under these names: 3-N-Phthaloylglyaminomethyl aniline, 95%, 2-(3-Aminobenzyl)isoindoline-1,3-dione, 98%, 2-((3-Aminophenyl)methyl)-2,3-dihydro-1H-isoindole-1,3-dione, 3-N-Phthaloylglyaminomethyl aniline, 98%, 98%, 3-N-Phthaloylglyaminomethyl aniline, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg.
2-[(3-aminophenyl)methyl]isoindole-1,3-dione (CAS 77147-14-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 2-[(3-aminophenyl)methyl]isoindole-1,3-dione. InChIKey: FOBVDBSEYFIUCA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[(3-aminophenyl)methyl]isoindole-1,3-dione |
| InChIKey | FOBVDBSEYFIUCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC(=CC=C3)N |
Computed by PubChem (NCBI)