1H-Indole-1,3-diyl diacetate, 98%
cas: 1986710-51-3 — see every product listed under this CAS number, including other names
1H-Indole-1,3-diyl diacetate, 98% (CAS 1986710-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A682099-250mg |
| cas | 1986710-51-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1049.00 Pln | |
| Ambeed | 100g | 3424.19 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1125.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(1-acetyloxyindol-3-yl) acetate (CAS 1986710-51-3) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: (1-acetyloxyindol-3-yl) acetate. InChIKey: BFOSGUOOSPMQOE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (1-acetyloxyindol-3-yl) acetate |
| InChIKey | BFOSGUOOSPMQOE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CN(C2=CC=CC=C21)OC(=O)C |
Computed by PubChem (NCBI)