Products 441800-93-7
CAS 441800-93-7 appears in our catalog under these names: 2-(Ethoxycarbonyl)-1h-indole-3-carboxylic acid, 95%, 2-(Ethoxycarbonyl)-1H-indole-3-carboxylic acid 97%, 2-(Ethoxycarbonyl)-1H-indole-3-carboxylic acid, 97%, 97%, 2-(Ethoxycarbonyl)-1H-indole-3-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-ethoxycarbonyl-1H-indole-3-carboxylic acid (CAS 441800-93-7) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-ethoxycarbonyl-1H-indole-3-carboxylic acid. InChIKey: HFKAHXLZJKJMKW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-ethoxycarbonyl-1H-indole-3-carboxylic acid |
| InChIKey | HFKAHXLZJKJMKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1)C(=O)O |
Computed by PubChem (NCBI)