CAS 93041-44-2 appears in our catalog under these names: 3-(2-Methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 95%, 3-(2-Methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 93041-44-2) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: KOQSJBSGCNLIJY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | KOQSJBSGCNLIJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2OC)C(=O)O |
Computed by PubChem (NCBI)