CAS 2940-24-1 appears in our catalog under these names: 2-(4-Methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid, 95%, 2-(4-Methoxyphenyl)-5-methyloxazole-4-carboxylic acid, 95+%, 2-(4-Methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid, 2-(4-Methoxyphenyl)-5-methyloxazole-4-carboxylic acid, 97%, 97%, 2-(4-Methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 500mg.
2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 2940-24-1) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: AAGVOCGVJGNEII-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | AAGVOCGVJGNEII-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)