cas: 1387445-50-2 — see every product listed under this CAS number, including other names
1H-Indole-1-carboxylic acid, 5-methoxy-7-methyl-, 1,1-dimethylethyl ester, 98%, 98% (CAS 1387445-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120GJ-100mg |
| cas | 1387445-50-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 25g | 2987.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methoxy-7-methylindole-1-carboxylate (CAS 1387445-50-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 5-methoxy-7-methylindole-1-carboxylate. InChIKey: OMZYGXJHKONVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 5-methoxy-7-methylindole-1-carboxylate |
| InChIKey | OMZYGXJHKONVSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(C=C2)C(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)