cas: 1387445-50-2 — see every product listed under this CAS number, including other names
tert-Butyl 5-methoxy-7-methyl-1H-indole-1-carboxylate 97% (CAS 1387445-50-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439209-250mg |
| cas | 1387445-50-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 670.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A439209 |
Tert-butyl 5-methoxy-7-methylindole-1-carboxylate (CAS 1387445-50-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 5-methoxy-7-methylindole-1-carboxylate. InChIKey: OMZYGXJHKONVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 5-methoxy-7-methylindole-1-carboxylate |
| InChIKey | OMZYGXJHKONVSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(C=C2)C(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)