cas: 937-27-9 — see every product listed under this CAS number, including other names
1H-Pyrrole-2,5-dicarboxylic acid, 97% (CAS 937-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209167-100MG |
| cas | 937-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 10g | 3512.32 Pln | |
| Fluorochem | 25g | 6589.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Pyrrole-2,5-dicarboxylic acid is a pyrroledicarboxylic acid in which the two carboxy groups are located at positions 2 and 5. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1H-pyrrole-2,5-dicarboxylic acid |
| InChIKey | JLUIOEOHOOLSJC-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)