cas: 937-27-9 — see every product listed under this CAS number, including other names
1H-Pyrrole-2,5-dicarboxylic acid, 97%, 97% (CAS 937-27-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117EMK-50mg |
| cas | 937-27-9 |
| size | 50mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 107.60 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Pyrrole-2,5-dicarboxylic acid is a pyrroledicarboxylic acid in which the two carboxy groups are located at positions 2 and 5. It has a role as a metabolite.
Source: ChEBI
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1H-pyrrole-2,5-dicarboxylic acid |
| InChIKey | JLUIOEOHOOLSJC-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)