1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid 97%
cas: 136818-50-3 — see every product listed under this CAS number, including other names
1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid 97% (CAS 136818-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101771-100mg |
| cas | 136818-50-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1110.19 Pln | |
| Ambeed | 25g | 1961.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A101771 |
1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 136818-50-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: DXMRZBGFYBCTLR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | DXMRZBGFYBCTLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=C2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)