cas: 136818-50-3 — see every product listed under this CAS number, including other names
1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 95% (CAS 136818-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076992-1G |
| cas | 136818-50-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 10g | 1101.71 Pln | |
| Fluorochem | 25g | 1955.58 Pln | |
| Fluorochem | 100g | 6636.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 136818-50-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: DXMRZBGFYBCTLR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | DXMRZBGFYBCTLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=C2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)