cas: 65115-91-5 — see every product listed under this CAS number, including other names
1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline (CAS 65115-91-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F866118-100MG |
| cas | 65115-91-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 419.66 Pln |
| delivery time | 3-4 weeks |
|---|
1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline (CAS 65115-91-5) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline. InChIKey: GGQHROHZSIPVQE-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline |
| InChIKey | GGQHROHZSIPVQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C4C2O4)N=C1 |
Computed by PubChem (NCBI)