CAS 66479-90-1 is the registry number for 6-Phenyl-furo[2,3-b]pyrazine, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-phenylfuro[2,3-b]pyrazine (CAS 66479-90-1) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 6-phenylfuro[2,3-b]pyrazine. InChIKey: FSEDFAYOEWWTBL-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 6-phenylfuro[2,3-b]pyrazine |
| InChIKey | FSEDFAYOEWWTBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=NC=CN=C3O2 |
Computed by PubChem (NCBI)