Products 32959-62-9
CAS 32959-62-9 appears in our catalog under these names: 2-(2-Pyridyl)benzoxazole, 97%, 2–(2–Pyridyl)benzoxazole, 2-(2-Pyridyl)benzoxazole, >97.0%(GC)(T), 2-(Pyridin-2-yl)benzo[d]oxazole 97%, 2-(Pyridin-2-Yl)Benzo[D]Oxazole, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
2-pyridin-2-yl-1,3-benzoxazole (CAS 32959-62-9) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 2-pyridin-2-yl-1,3-benzoxazole. InChIKey: WELSCYIRWKBEBZ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-pyridin-2-yl-1,3-benzoxazole |
| InChIKey | WELSCYIRWKBEBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)