CAS 65115-91-5 appears in our catalog under these names: 5,6-Epoxy-5,6-dihydro-[1,10]phenanthroline, 95%, 1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline, 95%, 95%, 1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline, 1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline (CAS 65115-91-5) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline. InChIKey: GGQHROHZSIPVQE-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline |
| InChIKey | GGQHROHZSIPVQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C4C2O4)N=C1 |
Computed by PubChem (NCBI)