CAS 13909-73-4 appears in our catalog under these names: 2',3',4'–Trimethoxyacetophenone, 2',3',4'-Trimethoxyacetophenone/ 98%, 2',3',4'-Trimethoxyacetophenone 96%, 2',3',4'-Trimethoxyacetophenone, 99.66%, 2',3',4'-Trimethoxyacetophenone, >97.0%(GC). Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, TCI. Available pack sizes: 100g, 10g, 25g, 5g, 500mg, 1g, 250 mg, 10mM/1mL.
1-(2,3,4-trimethoxyphenyl)ethanone (CAS 13909-73-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-(2,3,4-trimethoxyphenyl)ethanone. InChIKey: PKNAATJMQOUREZ-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-(2,3,4-trimethoxyphenyl)ethanone |
| InChIKey | PKNAATJMQOUREZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)OC)OC)OC |
Computed by PubChem (NCBI)