cas: 2179038-48-1 — see every product listed under this CAS number, including other names
2'-Bromo-4-methyl-4'-(trifluoromethoxy)-1,1'-biphenyl (CAS 2179038-48-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631137-1G |
| cas | 2179038-48-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6964.23 Pln | |
| Fluorochem | 5g | 20777.08 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene (CAS 2179038-48-1) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene. InChIKey: XTLMSVFLAOONLM-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 2-bromo-1-(4-methylphenyl)-4-(trifluoromethoxy)benzene |
| InChIKey | XTLMSVFLAOONLM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)OC(F)(F)F)Br |
Computed by PubChem (NCBI)