2'-Bromo-N,N-dimethyl-[1,1'-biphenyl]-4-amine, 95%
cas: 1185898-91-2 — see every product listed under this CAS number, including other names
2'-Bromo-N,N-dimethyl-[1,1'-biphenyl]-4-amine, 95% (CAS 1185898-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2721668-100mg |
| cas | 1185898-91-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 604.00 Pln | |
| Ambeed | 250mg | 1132.44 Pln | |
| Ambeed | 1g | 3257.31 Pln | |
| BLDpharm | 50mg | 408.77 Pln | |
| BLDpharm | 100mg | 647.57 Pln | |
| BLDpharm | 250mg | 1219.60 Pln | |
| BLDpharm | 1g | 3502.12 Pln | |
| Chemat | 50mg | 299.60 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 1g | 2512.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(2-bromophenyl)-N,N-dimethylaniline (CAS 1185898-91-2) is a chemical compound with the molecular formula C14H14BrN and a molecular weight of 276.17 g/mol. IUPAC name: 4-(2-bromophenyl)-N,N-dimethylaniline. InChIKey: VYFVIKIMTDRNFV-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN |
|---|---|
| Molecular weight | 276.17 g/mol |
| IUPAC name | 4-(2-bromophenyl)-N,N-dimethylaniline |
| InChIKey | VYFVIKIMTDRNFV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)