CAS 868372-36-5 is the registry number for 2-Bromo-6-mesitylpyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-6-(2,4,6-trimethylphenyl)pyridine (CAS 868372-36-5) is a chemical compound with the molecular formula C14H14BrN and a molecular weight of 276.17 g/mol. IUPAC name: 2-bromo-6-(2,4,6-trimethylphenyl)pyridine. InChIKey: HIKRRXNPAIMTQI-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN |
|---|---|
| Molecular weight | 276.17 g/mol |
| IUPAC name | 2-bromo-6-(2,4,6-trimethylphenyl)pyridine |
| InChIKey | HIKRRXNPAIMTQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NC(=CC=C2)Br)C |
Computed by PubChem (NCBI)