CAS 16547-15-2 appears in our catalog under these names: N-((3-Bromophenyl)methyl)-N-methylaniline, 95%, N-((3-Bromophenyl)methyl)-N-methylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-[(3-bromophenyl)methyl]-N-methylaniline (CAS 16547-15-2) is a chemical compound with the molecular formula C14H14BrN and a molecular weight of 276.17 g/mol. IUPAC name: N-[(3-bromophenyl)methyl]-N-methylaniline. InChIKey: YMPJOPNFFJIBNB-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN |
|---|---|
| Molecular weight | 276.17 g/mol |
| IUPAC name | N-[(3-bromophenyl)methyl]-N-methylaniline |
| InChIKey | YMPJOPNFFJIBNB-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)