Products 1185898-91-2

CAS 1185898-91-2 is the registry number for 2'-Bromo-N,N-dimethyl-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-bromophenyl)-N,N-dimethylaniline (CAS 1185898-91-2) is a chemical compound with the molecular formula C14H14BrN and a molecular weight of 276.17 g/mol. IUPAC name: 4-(2-bromophenyl)-N,N-dimethylaniline. InChIKey: VYFVIKIMTDRNFV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14BrN
Molecular weight276.17 g/mol
IUPAC name4-(2-bromophenyl)-N,N-dimethylaniline
InChIKeyVYFVIKIMTDRNFV-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)C2=CC=CC=C2Br

Computed by PubChem (NCBI)