CAS 1185898-91-2 is the registry number for 2'-Bromo-N,N-dimethyl-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(2-bromophenyl)-N,N-dimethylaniline (CAS 1185898-91-2) is a chemical compound with the molecular formula C14H14BrN and a molecular weight of 276.17 g/mol. IUPAC name: 4-(2-bromophenyl)-N,N-dimethylaniline. InChIKey: VYFVIKIMTDRNFV-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN |
|---|---|
| Molecular weight | 276.17 g/mol |
| IUPAC name | 4-(2-bromophenyl)-N,N-dimethylaniline |
| InChIKey | VYFVIKIMTDRNFV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)